| Product Name | 5-(Bromomethyl)-2,3-dihydro-1,4-benzodioxine |
| CAS No. | 214894-89-0 |
| Synonyms | 8-(bromomethyl)-2,3-dihydro-1,4-benzodioxine |
| InChI | InChI=1/C9H9BrO2/c10-6-7-2-1-3-8-9(7)12-5-4-11-8/h1-3H,4-6H2 |
| Molecular Formula | C9H9BrO2 |
| Molecular Weight | 229.0706 |
| Density | 1.549g/cm3 |
| Melting point | 69.4℃ |
| Boiling point | 295.7°C at 760 mmHg |
| Flash point | 137.9°C |
| Refractive index | 1.586 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
214894-89-0 5-(bromomethyl)-2,3-dihydro-1,4-benzodioxine
service@apichina.com