| Product Name | 5-(bromomethyl)-2,1,3-benzothiadiazole |
| CAS No. | 65858-50-6 |
| InChI | InChI=1/C7H5BrN2S/c8-4-5-1-2-6-7(3-5)10-11-9-6/h1-3H,4H2 |
| Molecular Formula | C7H5BrN2S |
| Molecular Weight | 229.097 |
| Density | 1.776g/cm3 |
| Melting point | 87℃ |
| Boiling point | 299.3°C at 760 mmHg |
| Flash point | 134.8°C |
| Refractive index | 1.726 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
65858-50-6 5-(bromomethyl)-2,1,3-benzothiadiazole
service@apichina.com