| Product Name | 5-(Bromomethyl)-1-methyl-1H-1,2,3-benzotriazole |
| CAS No. | 499770-76-2 |
| Synonyms | 5-(bromomethyl)-1-methyl-1H-benzo[d][1,2,3]triazole; 5-(Bromomethyl)-1-methyl-1H-benzotriazole; 5-(bromomethyl)-1-methyl-benzotriazole |
| InChI | InChI=1/C8H8BrN3/c1-12-8-3-2-6(5-9)4-7(8)10-11-12/h2-4H,5H2,1H3 |
| Molecular Formula | C8H8BrN3 |
| Molecular Weight | 226.0732 |
| Density | 1.66g/cm3 |
| Melting point | 115℃ |
| Boiling point | 355.735°C at 760 mmHg |
| Flash point | 168.943°C |
| Refractive index | 1.685 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
499770-76-2 5-(bromomethyl)-1-methyl-1h-1,2,3-benzotriazole
service@apichina.com