| Product Name | 5-Bromoindoxyl diacetate |
| CAS No. | 33588-54-4 |
| Synonyms | 1-Acetyl-5-bromoindol-3-ol acetate; N-acetyl-5-bromoindolyl acetate; 3-Acetoxy-1-acetyl-5-bromoindole; 1-acetyl-5-bromo-1H-indol-3-yl acetate |
| InChI | InChI=1/C12H10BrNO3/c1-7(15)14-6-12(17-8(2)16)10-5-9(13)3-4-11(10)14/h3-6H,1-2H3 |
| Molecular Formula | C12H10BrNO3 |
| Molecular Weight | 296.1167 |
| Density | 1.54g/cm3 |
| Melting point | 125-128℃ |
| Boiling point | 395.7°C at 760 mmHg |
| Flash point | 193.1°C |
| Refractive index | 1.616 |
| Safety | S24/25:Avoid contact with skin and eyes.; |
33588-54-4 5-bromoindoxyl diacetate
service@apichina.com