| Product Name | 5-Bromo-N-(carboxymethyl)anthranilic acid |
| CAS No. | 32253-75-1 |
| Synonyms | N-(4-Bromo-2-carboxyphenyl)glycine; 5-bromo-2-[(carboxymethyl)amino]benzoic acid; 5-bromo-2-[(carboxylatomethyl)amino]benzoate |
| InChI | InChI=1/C9H8BrNO4/c10-5-1-2-7(11-4-8(12)13)6(3-5)9(14)15/h1-3,11H,4H2,(H,12,13)(H,14,15)/p-2 |
| Molecular Formula | C9H6BrNO4 |
| Molecular Weight | 272.0533 |
| Melting point | 215-218℃ |
| Boiling point | 517°C at 760 mmHg |
| Flash point | 266.5°C |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
32253-75-1 5-bromo-n-(carboxymethyl)anthranilic acid
service@apichina.com