| Product Name | 5-Bromo-7-nitroindoline |
| CAS No. | 80166-90-1 |
| Synonyms | 5-Bromo-7-Nitro-2,3-dihydro-1H-indole |
| InChI | InChI=1/C8H7BrN2O2/c9-6-3-5-1-2-10-8(5)7(4-6)11(12)13/h3-4,10H,1-2H2 |
| Molecular Formula | C8H7BrN2O2 |
| Molecular Weight | 243.0574 |
| Density | 1.704g/cm3 |
| Boiling point | 344.2°C at 760 mmHg |
| Flash point | 162°C |
| Refractive index | 1.64 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
80166-90-1 5-bromo-7-nitroindoline
service@apichina.com