| Product Name | 5-bromo-4-methoxy-7-methylindane |
| CAS No. | 175136-09-1 |
| Synonyms | 5-bromo-4-methoxy-7-methyl-2,3-dihydro-1H-indene |
| InChI | InChI=1/C11H13BrO/c1-7-6-10(12)11(13-2)9-5-3-4-8(7)9/h6H,3-5H2,1-2H3 |
| Molecular Formula | C11H13BrO |
| Molecular Weight | 241.1243 |
| Density | 1.377g/cm3 |
| Melting point | 30℃ |
| Boiling point | 311°C at 760 mmHg |
| Flash point | 130.2°C |
| Refractive index | 1.572 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
175136-09-1 5-bromo-4-methoxy-7-methylindane
service@apichina.com