| Product Name | 5-Bromo-3-pyridylacetic acid |
| CAS No. | 39891-12-8 |
| Synonyms | 5-Bromo-3-pyridineacetic acid; (5-bromopyridin-3-yl)acetic acid |
| InChI | InChI=1/C7H6BrNO2/c8-6-1-5(2-7(10)11)3-9-4-6/h1,3-4H,2H2,(H,10,11) |
| Molecular Formula | C7H6BrNO2 |
| Molecular Weight | 216.032 |
| Density | 1.71g/cm3 |
| Boiling point | 349.9°C at 760 mmHg |
| Flash point | 165.4°C |
| Refractive index | 1.599 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
39891-12-8 5-bromo-3-pyridylacetic acid
service@apichina.com