| Product Name | 5-Bromo-2-methoxybenzyl alcohol |
| CAS No. | 80866-82-6 |
| Synonyms | 5-Bromo-o-anisyl alcohol; (5-bromo-2-methoxyphenyl)methanol; 5-Bromo-2-methoxybenzylalcohol |
| InChI | InChI=1/C8H9BrO2/c1-11-8-3-2-7(9)4-6(8)5-10/h2-4,10H,5H2,1H3 |
| Molecular Formula | C8H9BrO2 |
| Molecular Weight | 217.0599 |
| Density | 1.513g/cm3 |
| Melting point | 68-71℃ |
| Boiling point | 299.4°C at 760 mmHg |
| Flash point | 134.9°C |
| Refractive index | 1.57 |
| Safety | S24/25:Avoid contact with skin and eyes.; |
80866-82-6 5-bromo-2-methoxybenzyl alcohol
service@apichina.com
- Next:148501-34-2 shr3 protein
- Previous:148498-98-0 miniruby