| Product Name | 5-Bromo-2-fluoropyridine-3-boronic acid |
| CAS No. | 501435-91-2 |
| Synonyms | 5-Bromo-2-fluoro-3-pyridylboronic acid; (5-bromo-2-fluoropyridin-3-yl)boronic acid; 2-Fluoro-5-Bromopyridine-3-Boronic Acid |
| InChI | InChI=1/C5H4BBrFNO2/c7-3-1-4(6(10)11)5(8)9-2-3/h1-2,10-11H |
| Molecular Formula | C5H4BBrFNO2 |
| Molecular Weight | 219.8042 |
| Density | 1.86g/cm3 |
| Boiling point | 357.1°C at 760 mmHg |
| Flash point | 169.7°C |
| Refractive index | 1.574 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
501435-91-2 5-bromo-2-fluoropyridine-3-boronic acid
service@apichina.com