| Product Name | 5-Bromo-2-ethoxybenzaldehyde |
| CAS No. | 79636-94-5 |
| InChI | InChI=1/C9H9BrO2/c1-2-12-9-4-3-8(10)5-7(9)6-11/h3-6H,2H2,1H3 |
| Molecular Formula | C9H9BrO2 |
| Molecular Weight | 229.0706 |
| Density | 1.451g/cm3 |
| Melting point | 68℃ |
| Boiling point | 302.7°C at 760 mmHg |
| Flash point | 136.9°C |
| Refractive index | 1.573 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
79636-94-5 5-bromo-2-ethoxybenzaldehyde
service@apichina.com