| Product Name | 5-bromo-2,4-dimethyl-1,3-thiazole |
| CAS No. | 28599-52-2 |
| InChI | InChI=1/C5H6BrNS/c1-3-5(6)8-4(2)7-3/h1-2H3 |
| Molecular Formula | C5H6BrNS |
| Molecular Weight | 192.0768 |
| Density | 1.589g/cm3 |
| Boiling point | 221.1°C at 760 mmHg |
| Flash point | 87.5°C |
| Refractive index | 1.577 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
28599-52-2 5-bromo-2,4-dimethyl-1,3-thiazole
service@apichina.com