| Product Name | 5-Bromo-2,3-dihydro-1,4-benzodioxine |
| CAS No. | 58328-39-5 |
| InChI | InChI=1/C8H7BrO2/c9-6-2-1-3-7-8(6)11-5-4-10-7/h1-3H,4-5H2 |
| Molecular Formula | C8H7BrO2 |
| Molecular Weight | 215.044 |
| Density | 1.598g/cm3 |
| Melting point | 55.5℃ |
| Boiling point | 260.9°C at 760 mmHg |
| Flash point | 119.6°C |
| Refractive index | 1.579 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
58328-39-5 5-bromo-2,3-dihydro-1,4-benzodioxine
service@apichina.com