| Product Name | 5-Bromo-2,3-difluorophenol |
| CAS No. | 186590-26-1 |
| Synonyms | Bromodifluorophenol5; 3-Bromo-5,6-difluorophenol; 2,3-difluoro-5-bromophenol; bis[3-(trifluoromethyl)phenyl]methanone |
| InChI | InChI=1/C6H3BrF2O/c7-3-1-4(8)6(9)5(10)2-3/h1-2,10H |
| Molecular Formula | C6H3BrF2O |
| Molecular Weight | 208.9882 |
| Density | 1.858g/cm3 |
| Boiling point | 212.2°C at 760 mmHg |
| Flash point | 82.1°C |
| Refractive index | 1.549 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
186590-26-1 5-bromo-2,3-difluorophenol
service@apichina.com