| Product Name | 5-Bromo-2,3-difluoroanisole |
| CAS No. | 261762-35-0 |
| Synonyms | 2.3-Difluoro-5-Bromoanisole; 5-bromo-1,2-difluoro-3-methoxybenzene |
| InChI | InChI=1/C7H5BrF2O/c1-11-6-3-4(8)2-5(9)7(6)10/h2-3H,1H3 |
| Molecular Formula | C7H5BrF2O |
| Molecular Weight | 223.0148 |
| Density | 1.615g/cm3 |
| Boiling point | 193.7°C at 760 mmHg |
| Flash point | 84.6°C |
| Refractive index | 1.5 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
261762-35-0 5-bromo-2,3-difluoroanisole
service@apichina.com