| Product Name | 5-bromo-2,1,3-benzothiadiazole |
| CAS No. | 1753-75-9 |
| InChI | InChI=1/C6H3BrN2S/c7-4-1-2-5-6(3-4)9-10-8-5/h1-3H |
| Molecular Formula | C6H3BrN2S |
| Molecular Weight | 215.0704 |
| Density | 1.859g/cm3 |
| Melting point | 51℃ |
| Boiling point | 272.2°C at 760 mmHg |
| Flash point | 118.4°C |
| Refractive index | 1.733 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
1753-75-9 5-bromo-2,1,3-benzothiadiazole
service@apichina.com