| Product Name | 5-Bromo-§ |
| CAS No. | 7355-22-8 |
| Synonyms | 5-Bromo-2,4-dihydroxybenzoic acid monohydrate; 5-bromo-2,4-dihydroxybenzoic acid |
| InChI | InChI=1/C7H5BrO4/c8-4-1-3(7(11)12)5(9)2-6(4)10/h1-2,9-10H,(H,11,12) |
| Molecular Formula | C7H5BrO4 |
| Molecular Weight | 233.0162 |
| Density | 2.026g/cm3 |
| Boiling point | 436.7°C at 760 mmHg |
| Flash point | 217.9°C |
| Refractive index | 1.703 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
7355-22-8 5-bromo-§
service@apichina.com