| Product Name | 5-(benzylthio)-4-bromo-2-phenylpyridazin-3(2H)-one |
| CAS No. | 97136-93-1 |
| Synonyms | 5-(benzylsulfanyl)-4-bromo-2-phenylpyridazin-3(2H)-one |
| InChI | InChI=1/C17H13BrN2OS/c18-16-15(22-12-13-7-3-1-4-8-13)11-19-20(17(16)21)14-9-5-2-6-10-14/h1-11H,12H2 |
| Molecular Formula | C17H13BrN2OS |
| Molecular Weight | 373.2669 |
| Density | 1.43g/cm3 |
| Melting point | 137℃ |
| Boiling point | 450.6°C at 760 mmHg |
| Flash point | 226.3°C |
| Refractive index | 1.662 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
97136-93-1 5-(benzylthio)-4-bromo-2-phenylpyridazin-3(2h)-one
service@apichina.com