| Product Name | 5-Benzyloxyindole-2-carboxylic acid |
| CAS No. | 6640-09-1 |
| Synonyms | 5-(Benzyloxy)-1H-indole-2-carboxylic acid |
| InChI | InChI=1/C16H13NO3/c18-16(19)15-9-12-8-13(6-7-14(12)17-15)20-10-11-4-2-1-3-5-11/h1-9,17H,10H2,(H,18,19) |
| Molecular Formula | C16H13NO3 |
| Molecular Weight | 267.2793 |
| Density | 1.342g/cm3 |
| Melting point | 192℃ |
| Boiling point | 531.1°C at 760 mmHg |
| Flash point | 275°C |
| Refractive index | 1.696 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
6640-09-1 5-benzyloxyindole-2-carboxylic acid
service@apichina.com