| Product Name | 5-benzyloxyindole-2-carboxylic acid*ethyl ester C |
| CAS No. | 37033-95-7 |
| Synonyms | Ethyl 5-(benzyloxy)-1H-indole-2-carboxylate; Ethyl 5-(benzyloxy)indole-2-carboxylate; 5-(Phenylmethoxy)-1H-Indole-2-Carboxylic Acid Ethyl Ester |
| InChI | InChI=1/C18H17NO3/c1-2-21-18(20)17-11-14-10-15(8-9-16(14)19-17)22-12-13-6-4-3-5-7-13/h3-11,19H,2,12H2,1H3 |
| Molecular Formula | C18H17NO3 |
| Molecular Weight | 295.3325 |
| Density | 1.225g/cm3 |
| Melting point | 162℃ |
| Boiling point | 481.4°C at 760 mmHg |
| Flash point | 244.9°C |
| Refractive index | 1.633 |
| Safety | S22:Do not inhale dust.; S24/25:Avoid contact with skin and eyes.; |
37033-95-7 5-benzyloxyindole-2-carboxylic acid*ethyl ester c
service@apichina.com