| Product Name | 5-(Benzyloxy)-2-bromo-4-methylaniline |
| CAS No. | 499770-88-6 |
| InChI | InChI=1/C14H14BrNO/c1-10-7-12(15)13(16)8-14(10)17-9-11-5-3-2-4-6-11/h2-8H,9,16H2,1H3 |
| Molecular Formula | C14H14BrNO |
| Molecular Weight | 292.1711 |
| Density | 1.398g/cm3 |
| Melting point | 138.3℃ |
| Boiling point | 404.7°C at 760 mmHg |
| Flash point | 198.6°C |
| Refractive index | 1.628 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
499770-88-6 5-(benzyloxy)-2-bromo-4-methylaniline
service@apichina.com