| Product Name | 5-(benzyloxy)-1H-indole-2-carbohydrazide |
| CAS No. | 20948-66-7 |
| InChI | InChI=1/C16H15N3O2/c17-19-16(20)15-9-12-8-13(6-7-14(12)18-15)21-10-11-4-2-1-3-5-11/h1-9,18H,10,17H2,(H,19,20) |
| Molecular Formula | C16H15N3O2 |
| Molecular Weight | 281.3092 |
| Density | 1.313g/cm3 |
| Melting point | 219℃ |
| Refractive index | 1.694 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
20948-66-7 5-(benzyloxy)-1h-indole-2-carbohydrazide
service@apichina.com