| Product Name | (5-benzylfuran-3-yl)methyl 3-(cyclopentylidenemethyl)-2,2-dimethylcyclopropanecarboxylate |
| CAS No. | 22431-62-5;24380-83-4;28434-02-8;51202-40-5 |
| InChI | InChI=1/C24H28O3/c1-24(2)21(14-18-10-6-7-11-18)22(24)23(25)27-16-19-13-20(26-15-19)12-17-8-4-3-5-9-17/h3-5,8-9,13-15,21-22H,6-7,10-12,16H2,1-2H3/t21-,22+/m1/s1 |
| Molecular Formula | C24H28O3 |
| Molecular Weight | 364.4773 |
| Refractive index | 1.6 |
22431-62-5;24380-83-4;28434-02-8;51202-40-5 (5-benzylfuran-3-yl)methyl 3-(cyclopentylidenemethyl)-2,
service@apichina.com