| Product Name | 5-Benzoylpentanoic acid |
| CAS No. | 4144-62-1 |
| Synonyms | 6-Oxo-6-phenylhexanoic acid |
| InChI | InChI=1/C12H14O3/c13-11(8-4-5-9-12(14)15)10-6-2-1-3-7-10/h1-3,6-7H,4-5,8-9H2,(H,14,15) |
| Molecular Formula | C12H14O3 |
| Molecular Weight | 206.2378 |
| Density | 1.135g/cm3 |
| Boiling point | 385.3°C at 760 mmHg |
| Flash point | 201°C |
| Refractive index | 1.533 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
4144-62-1 5-benzoylpentanoic acid
service@apichina.com