| Product Name | 5-aminobenzene-1,3-diol hydrochloride |
| CAS No. | 6318-56-5 |
| Synonyms | 5-aminobenzene-1,3-diol; 5-aminobenzene-1,3-diol hydrochloride (1:1) |
| InChI | InChI=1/C6H7NO2.ClH/c7-4-1-5(8)3-6(9)2-4;/h1-3,8-9H,7H2;1H |
| Molecular Formula | C6H8ClNO2 |
| Molecular Weight | 161.5862 |
| Melting point | 182℃ |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
6318-56-5 5-aminobenzene-1,3-diol hydrochloride
service@apichina.com