| Product Name | 5-Amino-3-phenyl-1,2,4-thiadiazole |
| CAS No. | 17467-15-1 |
| Synonyms | 3-phenyl-1,2,4-thiadiazol-5-ylamine; 3-methylhex-2-ene; 3-phenyl-1,2,4-thiadiazol-5-amine |
| InChI | InChI=1/C8H7N3S/c9-8-10-7(11-12-8)6-4-2-1-3-5-6/h1-5H,(H2,9,10,11) |
| Molecular Formula | C8H7N3S |
| Molecular Weight | 177.2263 |
| Density | 1.333g/cm3 |
| Melting point | 152-156℃ |
| Boiling point | 359°C at 760 mmHg |
| Flash point | 170.9°C |
| Refractive index | 1.669 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S24/25:Avoid contact with skin and eyes.; |
17467-15-1 5-amino-3-phenyl-1,2,4-thiadiazole
service@apichina.com