| Product Name | 5-amino-3-(4-chlorophenyl)-1H-pyrazole-4-carbonitrile |
| CAS No. | 42754-62-1 |
| Synonyms | 3-amino-5-(4-chlorophenyl)-1H-pyrazole-4-carbonitrile |
| InChI | InChI=1/C10H7ClN4/c11-7-3-1-6(2-4-7)9-8(5-12)10(13)15-14-9/h1-4H,(H3,13,14,15) |
| Molecular Formula | C10H7ClN4 |
| Molecular Weight | 218.6424 |
| Density | 1.48g/cm3 |
| Melting point | 212℃ |
| Boiling point | 554.7°C at 760 mmHg |
| Flash point | 289.3°C |
| Refractive index | 1.688 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S36/37:Wear suitable protective clothing and gloves.; |
42754-62-1 5-amino-3-(4-chlorophenyl)-1h-pyrazole-4-carbonitrile
service@apichina.com