| Product Name | 5-amino-1-(4-chlorophenyl)-1H-pyrazole-4-carbonitrile |
| CAS No. | 51516-67-7 |
| InChI | InChI=1/C10H7ClN4/c11-8-1-3-9(4-2-8)15-10(13)7(5-12)6-14-15/h1-4,6H,13H2 |
| Molecular Formula | C10H7ClN4 |
| Molecular Weight | 218.6424 |
| Density | 1.41g/cm3 |
| Melting point | 170℃ |
| Boiling point | 424.2°C at 760 mmHg |
| Flash point | 210.4°C |
| Refractive index | 1.686 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S36/37:Wear suitable protective clothing and gloves.; |
51516-67-7 5-amino-1-(4-chlorophenyl)-1h-pyrazole-4-carbonitrile
service@apichina.com