| Product Name | 5-Acetylthiophene-2-carboxylic acid |
| CAS No. | 4066-41-5 |
| Synonyms | -5-Acetyl-thiophene-2-carboxylic acid; ATC; LABOTEST-BB LT00454683; BUTTPARK 121\06-15; AKOS MSC-0226; 5-ACETYL-2-THIOPHENECARBOXYLIC ACID; RARECHEM AL BO 0535; 5-Acetylthiophene-2-CarboxylicAcid98%; 5-Acetylthiophene-2-Carboxylic Acid 98%; 5-acetylthiophene-2-carboxylate; 5-Acetyl-thiophene-2- carboxylic acid |
| InChI | InChI=1/C7H6O3S/c1-4(8)5-2-3-6(11-5)7(9)10/h2-3H,1H3,(H,9,10) |
| Molecular Formula | C7H6O3S |
| Molecular Weight | 170.1857 |
| Density | 1.383g/cm3 |
| Melting point | 204-205℃ |
| Boiling point | 385.2°C at 760 mmHg |
| Flash point | 186.8°C |
| Refractive index | 1.591 |
| Hazard Symbols |  Xi:; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
4066-41-5 5-acetylthiophene-2-carboxylic acid
service@apichina.com