| Product Name | 5-Acetylthiophene-2-boronic acid |
| CAS No. | 206551-43-1 |
| Synonyms | (5-acetylthiophen-2-yl)boronic acid; 5-Acetyl-2-thiopheneboronic acid; 2-Acetylthiphene-2-boronic acid; 2-ACETYLTHIOPHENE-5-BORONIC ACID; 5-Acetyl-2-thienylboronicAcid; 5-Acetylthiophen-2-Ylboronic Acid |
| InChI | InChI=1/C6H7BO3S/c1-4(8)5-2-3-6(11-5)7(9)10/h2-3,9-10H,1H3 |
| Molecular Formula | C6H7BO3S |
| Molecular Weight | 169.994 |
| Density | 1.34g/cm3 |
| Melting point | 133-138℃ |
| Boiling point | 399.3°C at 760 mmHg |
| Flash point | 195.3°C |
| Refractive index | 1.556 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
206551-43-1 5-acetylthiophene-2-boronic acid
service@apichina.com