| Product Name | 5-Acetamido-2-nitrobenzoic acid,98% |
| CAS No. | 4368-83-6 |
| Synonyms | 5-(Acetylamino)-2-nitrobenzoic acid; 5-(acetylamino)-2-nitrobenzoate |
| InChI | InChI=1/C9H8N2O5/c1-5(12)10-6-2-3-8(11(15)16)7(4-6)9(13)14/h2-4H,1H3,(H,10,12)(H,13,14)/p-1 |
| Molecular Formula | C9H7N2O5 |
| Molecular Weight | 223.1628 |
| Boiling point | 522.9°C at 760 mmHg |
| Flash point | 270.1°C |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
4368-83-6 5-acetamido-2-nitrobenzoic acid,98%
service@apichina.com