| Product Name | 5,7-Difluoro-2,3-dihydrobenzo[b]furan |
| CAS No. | 175203-20-0 |
| Synonyms | 5,7-difluoro-2,3-dihydro-1-benzofuran |
| InChI | InChI=1/C8H6F2O/c9-6-3-5-1-2-11-8(5)7(10)4-6/h3-4H,1-2H2 |
| Molecular Formula | C8H6F2O |
| Molecular Weight | 156.1294 |
| Density | 1.323g/cm3 |
| Boiling point | 185.6°C at 760 mmHg |
| Flash point | 72.4°C |
| Refractive index | 1.512 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
175203-20-0 5,7-difluoro-2,3-dihydrobenzo[b]furan
service@apichina.com