| Product Name | 5,6-Diphenyl-3-hydroxy-1,2,4-triazine |
| CAS No. | 4512-00-9 |
| Synonyms | 3-Hydroxy-5,6-diphenyl-1,2,4-triazine; 5,6-diphenyl-1,2,4-triazin-3(2H)-one |
| InChI | InChI=1/C15H11N3O/c19-15-16-13(11-7-3-1-4-8-11)14(17-18-15)12-9-5-2-6-10-12/h1-10H,(H,16,18,19) |
| Molecular Formula | C15H11N3O |
| Molecular Weight | 249.2673 |
| Density | 1.24g/cm3 |
| Boiling point | 476.4°C at 760 mmHg |
| Flash point | 241.9°C |
| Refractive index | 1.662 |
| Risk Codes | R22:Harmful if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
4512-00-9 5,6-diphenyl-3-hydroxy-1,2,4-triazine
service@apichina.com