| Product Name | 5,6-Dimethoxyindole-2-carboxylic acid |
| CAS No. | 88210-96-2 |
| Synonyms | 5,6-Dimethoyxindole-2-carboxylic acid; 5,6-Dica; 5,6-Dimethoxyindolyl-2-carboxylic acid; 1H-Indole-2-carboxylic acid, 5,6-dimethoxy-; 5,6-dimethoxy-1H-indole-2-carboxylic acid |
| InChI | InChI=1/C11H11NO4/c1-15-9-4-6-3-8(11(13)14)12-7(6)5-10(9)16-2/h3-5,12H,1-2H3,(H,13,14) |
| Molecular Formula | C11H11NO4 |
| Molecular Weight | 221.2093 |
| Density | 1.362g/cm3 |
| Boiling point | 456.2°C at 760 mmHg |
| Flash point | 229.7°C |
| Refractive index | 1.644 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
88210-96-2 5,6-dimethoxyindole-2-carboxylic acid
service@apichina.com