| Product Name | 5,6-Dimethoxyindole-2-carboxylic acid ethyl ester |
| CAS No. | 16382-18-6 |
| Synonyms | Ethyl 5,6-dimethoxyindole-2-carboxylate; ethyl 5,6-dimethoxy-1H-indole-2-carboxylate |
| InChI | InChI=1/C13H15NO4/c1-4-18-13(15)10-5-8-6-11(16-2)12(17-3)7-9(8)14-10/h5-7,14H,4H2,1-3H3 |
| Molecular Formula | C13H15NO4 |
| Molecular Weight | 249.2625 |
| Density | 1.22g/cm3 |
| Boiling point | 401°C at 760 mmHg |
| Flash point | 196.3°C |
| Refractive index | 1.583 |
| Safety | S22:Do not inhale dust.; S24/25:Avoid contact with skin and eyes.; |
16382-18-6 5,6-dimethoxyindole-2-carboxylic acid ethyl ester
service@apichina.com