| Product Name | 5,6-Dihydroxy-7-methoxyflavone |
| CAS No. | 29550-13-8 |
| Synonyms | Baicalein 7-methyl ether; 5,6-dihydroxy-7-methoxy-2-phenyl-4H-chromen-4-one |
| InChI | InChI=1/C16H12O5/c1-20-13-8-12-14(16(19)15(13)18)10(17)7-11(21-12)9-5-3-2-4-6-9/h2-8,18-19H,1H3 |
| Molecular Formula | C16H12O5 |
| Molecular Weight | 284.2635 |
| Density | 1.42g/cm3 |
| Boiling point | 541.1°C at 760 mmHg |
| Flash point | 207.5°C |
| Refractive index | 1.668 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
29550-13-8 5,6-dihydroxy-7-methoxyflavone
service@apichina.com