| Product Name | 5,6-dichloronicotinic acid |
| CAS No. | 41667-95-2 |
| Synonyms | 5,6-Dichloropyridine-3-carboxylic acid; 5,6-dichloro nicotinic acid |
| InChI | InChI=1/C6H3Cl2NO2/c7-4-1-3(6(10)11)2-9-5(4)8/h1-2H,(H,10,11) |
| Molecular Formula | C6H3Cl2NO2 |
| Molecular Weight | 191.9995 |
| Density | 1.612g/cm3 |
| Melting point | 164-168℃ |
| Boiling point | 342.1°C at 760 mmHg |
| Flash point | 160.7°C |
| Refractive index | 1.605 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S22:; S24/25:; |
41667-95-2 5,6-dichloronicotinic acid
service@apichina.com