| Product Name | 5,6-Dichlorobenzimidazole-2-thiol |
| CAS No. | 19462-98-7 |
| Synonyms | 5,6-Dichloro-1H-benzo[d]imidazole-2-thiol; 5,6-dichloro-1,3-dihydro-2H-benzimidazole-2-thione |
| InChI | InChI=1/C7H4Cl2N2S/c8-3-1-5-6(2-4(3)9)11-7(12)10-5/h1-2H,(H2,10,11,12) |
| Molecular Formula | C7H4Cl2N2S |
| Molecular Weight | 219.0911 |
| Density | 1.68g/cm3 |
| Melting point | 300℃ |
| Boiling point | 329.8°C at 760 mmHg |
| Flash point | 153.3°C |
| Refractive index | 1.755 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
19462-98-7 5,6-dichlorobenzimidazole-2-thiol
service@apichina.com