| Product Name | 5,6-bis(benzyloxy)-1H-indole-2-carboxylic acid |
| CAS No. | 4966-40-9 |
| InChI | InChI=1/C23H19NO4/c25-23(26)20-11-18-12-21(27-14-16-7-3-1-4-8-16)22(13-19(18)24-20)28-15-17-9-5-2-6-10-17/h1-13,24H,14-15H2,(H,25,26) |
| Molecular Formula | C23H19NO4 |
| Molecular Weight | 373.4013 |
| Density | 1.315g/cm3 |
| Boiling point | 622.2°C at 760 mmHg |
| Flash point | 330.1°C |
| Refractive index | 1.684 |
4966-40-9 5,6-bis(benzyloxy)-1h-indole-2-carboxylic acid
service@apichina.com