| Product Name | 5,6-Benzoquinoline |
| CAS No. | 85-02-9 |
| Synonyms | beta-Naphthoquinoline; 1-Azaphenanthrene; Benzo[f]quinoline; Benzoquinoline; benzo(f)quinoline |
| InChI | InChI=1/C13H9N/c1-2-5-11-10(4-1)7-8-13-12(11)6-3-9-14-13/h1-9H |
| Molecular Formula | C13H9N |
| Molecular Weight | 179.2173 |
| Density | 1.187g/cm3 |
| Melting point | 89-91℃ |
| Boiling point | 350.4°C at 760 mmHg |
| Flash point | 155.9°C |
| Refractive index | 1.726 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; R40:Possible risks of irreversible effects.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
85-02-9 5,6-benzoquinoline
service@apichina.com