| Sales Email | Service@apichina.com |
| CAS No. | 16865-27-3 |
| Product Name | 5-(5-nitro-2-furyl)-1,3,4-thiadiazole-2-thiol |
| Synonyms | 5-(5-nitrofuran-2-yl)-1,3,4-thiadiazole-2(3H)-thione |
| InChI | InChI=1/C6H3N3O3S2/c10-9(11)4-2-1-3(12-4)5-7-8-6(13)14-5/h1-2H,(H,8,13) |
| Molecular Formula | C6H3N3O3S2 |
| Molecular Weight | 229.2363 |
| Density | 1.96g/cm3 |
| Melting point | 175℃ |
| Boiling point | 363.9°C at 760 mmHg |
| Flash point | 173.9°C |
| Refractive index | 1.879 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
