| Product Name | 5-(5-Chloro-2-thienyl)-1H-tetrazole |
| CAS No. | 58884-89-2 |
| Synonyms | 5-(5-chlorothiophen-2-yl)-2H-tetrazole |
| InChI | InChI=1/C5H3ClN4S/c6-4-2-1-3(11-4)5-7-9-10-8-5/h1-2H,(H,7,8,9,10) |
| Molecular Formula | C5H3ClN4S |
| Molecular Weight | 186.6221 |
| Density | 1.634g/cm3 |
| Boiling point | 383.7°C at 760 mmHg |
| Flash point | 185.8°C |
| Refractive index | 1.673 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
58884-89-2 5-(5-chloro-2-thienyl)-1h-tetrazole
service@apichina.com