| Product Name | 5-[4-(Methylthio)phenyl]-1H-tetrazole |
| CAS No. | 138689-79-9 |
| Synonyms | 5-[4-(methylsulfanyl)phenyl]-2H-tetrazole |
| InChI | InChI=1/C8H8N4S/c1-13-7-4-2-6(3-5-7)8-9-11-12-10-8/h2-5H,1H3,(H,9,10,11,12) |
| Molecular Formula | C8H8N4S |
| Molecular Weight | 192.2409 |
| Density | 1.38g/cm3 |
| Boiling point | 389.4°C at 760 mmHg |
| Flash point | 189.3°C |
| Refractive index | 1.662 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
138689-79-9 5-[4-(methylthio)phenyl]-1h-tetrazole
service@apichina.com