| Product Name | 5-(4-methoxyphenyl)-1,3-oxazole-4-carboxylic acid |
| CAS No. | 89205-07-2 |
| InChI | InChI=1/C11H9NO4/c1-15-8-4-2-7(3-5-8)10-9(11(13)14)12-6-16-10/h2-6H,1H3,(H,13,14) |
| Molecular Formula | C11H9NO4 |
| Molecular Weight | 219.1935 |
| Density | 1.31g/cm3 |
| Melting point | 154℃ |
| Boiling point | 388.9°C at 760 mmHg |
| Flash point | 189°C |
| Refractive index | 1.569 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
89205-07-2 5-(4-methoxyphenyl)-1,3-oxazole-4-carboxylic acid
service@apichina.com