| Product Name | 5-(4-Diethylaminobenzylidene)rhodanine |
| CAS No. | 35778-58-6 |
| Synonyms | 5-[4-(Diethylamino)benzylidene]rhodanine; (5E)-5-[4-(diethylamino)benzylidene]-2-sulfanyl-1,3-thiazol-4(5H)-one; (5Z)-5-[4-(diethylamino)benzylidene]-2-thioxo-1,3-thiazolidin-4-one; 5-{[4-(diethylamino)phenyl]methylidene}-2-thioxo-1,3-thiazolidin-4-one |
| InChI | InChI=1/C14H16N2OS2/c1-3-16(4-2)11-7-5-10(6-8-11)9-12-13(17)15-14(18)19-12/h5-9H,3-4H2,1-2H3,(H,15,17,18) |
| Molecular Formula | C14H16N2OS2 |
| Molecular Weight | 292.4196 |
| Density | 1.29g/cm3 |
| Melting point | 161-164℃ |
| Refractive index | 1.668 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
35778-58-6 5-(4-diethylaminobenzylidene)rhodanine
service@apichina.com