| Product Name | 5-[(4-bromo-3,5-dimethyl-1H-pyrazol-1-yl)methyl]-2-furoic acid |
| CAS No. | 306935-28-4 |
| Synonyms | 5-[(4-bromo-3,5-dimethyl-1H-pyrazol-1-yl)methyl]furan-2-carboxylic acid |
| InChI | InChI=1/C11H11BrN2O3/c1-6-10(12)7(2)14(13-6)5-8-3-4-9(17-8)11(15)16/h3-4H,5H2,1-2H3,(H,15,16) |
| Molecular Formula | C11H11BrN2O3 |
| Molecular Weight | 299.1206 |
| Density | 1.66g/cm3 |
| Melting point | 207℃ |
| Boiling point | 465°C at 760 mmHg |
| Flash point | 235°C |
| Refractive index | 1.646 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
306935-28-4 5-[(4-bromo-3,5-dimethyl-1h-pyrazol-1-yl)methyl]-2-furoic acid
service@apichina.com