| Product Name | 5-[(3-nitro-2-pyridyl)thio]-1,3,4-thiadiazol-2-amine |
| CAS No. | 499771-19-6 |
| Synonyms | 5-[(3-nitropyridin-2-yl)sulfanyl]-1,3,4-thiadiazol-2-amine |
| InChI | InChI=1/C7H5N5O2S2/c8-6-10-11-7(16-6)15-5-4(12(13)14)2-1-3-9-5/h1-3H,(H2,8,10) |
| Molecular Formula | C7H5N5O2S2 |
| Molecular Weight | 255.2769 |
| Density | 1.72g/cm3 |
| Melting point | 214℃ |
| Boiling point | 505.3°C at 760 mmHg |
| Flash point | 259.4°C |
| Refractive index | 1.753 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S36/37:Wear suitable protective clothing and gloves.; |
499771-19-6 5-[(3-nitro-2-pyridyl)thio]-1,3,4-thiadiazol-2-amine
service@apichina.com