| Product Name | 5-(3-Methoxyphenyl)-1H-tetrazole |
| CAS No. | 73096-36-3 |
| Synonyms | 5-(3-methoxyphenyl)tetrazol-1-ide; 5-(3-methoxyphenyl)-2H-tetrazole |
| InChI | InChI=1/C8H8N4O/c1-13-7-4-2-3-6(5-7)8-9-11-12-10-8/h2-5H,1H3,(H,9,10,11,12) |
| Molecular Formula | C8H8N4O |
| Molecular Weight | 176.1753 |
| Density | 1.288g/cm3 |
| Boiling point | 377.5°C at 760 mmHg |
| Flash point | 137.4°C |
| Refractive index | 1.591 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
73096-36-3 5-(3-methoxyphenyl)-1h-tetrazole
service@apichina.com