| Product Name | 5-(3-Chlorophenyl)-1H-tetrazole |
| CAS No. | 41421-28-7 |
| Synonyms | 5-(3-chlorophenyl)-2H-tetrazole; 5-(3-chlorophenyl)tetrazol-1-ide |
| InChI | InChI=1/C7H4ClN4/c8-6-3-1-2-5(4-6)7-9-11-12-10-7/h1-4H/q-1 |
| Molecular Formula | C7H4ClN4 |
| Molecular Weight | 179.587 |
| Boiling point | 372.8°C at 760 mmHg |
| Flash point | 211°C |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
41421-28-7 5-(3-chlorophenyl)-1h-tetrazole
service@apichina.com