| Product Name | 5-(2-thienyl)tetrahydrothiophen-3-one |
| CAS No. | 108372-48-1 |
| Synonyms | 2,3-dihydro-2,2'-bithiophen-4(5H)-one |
| InChI | InChI=1/C8H8OS2/c9-6-4-8(11-5-6)7-2-1-3-10-7/h1-3,8H,4-5H2 |
| Molecular Formula | C8H8OS2 |
| Molecular Weight | 184.2785 |
| Density | 1.331g/cm3 |
| Melting point | 55℃ |
| Boiling point | 324.6°C at 760 mmHg |
| Flash point | 150.1°C |
| Refractive index | 1.635 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
108372-48-1 5-(2-thienyl)tetrahydrothiophen-3-one
service@apichina.com